C24H19Cl2FN4O2S — CID 134115941
2-chloro-N-[(3E)-6-chloro-3-[(4-methylsulfanylphenyl)carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]-4-fluorobenzamide (PubChem CID 134115941) has the molecular formula C24H19Cl2FN4O2S and a molecular weight of 517.41 g/mol. Its IUPAC name is 2-chloro-N-[(3E)-6-chloro-3-[(4-methylsulfanylphenyl)carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[(3E)-6-chloro-3-[(4-methylsulfanylphenyl)carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 134115941 |
| Molecular Formula | C24H19Cl2FN4O2S |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | 2-chloro-N-[(3E)-6-chloro-3-[(4-methylsulfanylphenyl)carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]-4-fluorobenzamide |
| SMILES | CSc1ccc(NC(=O)N/N=C2\c3ccc(Cl)cc3CC2NC(=O)c2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C24H19Cl2FN4O2S/c1-34-17-6-4-16(5-7-17)28-24(33)31-30-22-18-8-2-14(25)10-13(18)11-21(22)29-23(32)19-9-3-15(27)12-20(19)26/h2-10,12,21H,11H2,1H3,(H,29,32)(H2,28,31,33)/b30-22+ |
| InChIKey | RHTOCKGSFYXATH-JBASAIQMSA-N |
| XLogP | 5.73 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|