C24H21ClN4O2 — CID 134107270
3-chloro-N-[(3E)-3-[(4-methylphenyl)carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide (PubChem CID 134107270) has the molecular formula C24H21ClN4O2 and a molecular weight of 432.91 g/mol. Its IUPAC name is 3-chloro-N-[(3E)-3-[(4-methylphenyl)carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide.
| Compound Name | 3-chloro-N-[(3E)-3-[(4-methylphenyl)carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide |
|---|---|
| PubChem CID | 134107270 |
| Molecular Formula | C24H21ClN4O2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-chloro-N-[(3E)-3-[(4-methylphenyl)carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)N/N=C2\c3ccccc3CC2NC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H21ClN4O2/c1-15-9-11-19(12-10-15)26-24(31)29-28-22-20-8-3-2-5-16(20)14-21(22)27-23(30)17-6-4-7-18(25)13-17/h2-13,21H,14H2,1H3,(H,27,30)(H2,26,29,31)/b28-22+ |
| InChIKey | GPPBZHZJXXFSGA-XAYXJRQQSA-N |
| XLogP | 4.53 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|