C24H18ClF3N4O3 — CID 134096267
3-chloro-N-[(3E)-3-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide (PubChem CID 134096267) has the molecular formula C24H18ClF3N4O3 and a molecular weight of 502.88 g/mol. Its IUPAC name is 3-chloro-N-[(3E)-3-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide.
| Compound Name | 3-chloro-N-[(3E)-3-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide |
|---|---|
| PubChem CID | 134096267 |
| Molecular Formula | C24H18ClF3N4O3 |
| Molecular Weight | 502.88 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 3-chloro-N-[(3E)-3-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide |
| SMILES | O=C(N/N=C1\c2ccccc2CC1NC(=O)c1cccc(Cl)c1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H18ClF3N4O3/c25-16-6-3-5-15(12-16)22(33)30-20-13-14-4-1-2-7-19(14)21(20)31-32-23(34)29-17-8-10-18(11-9-17)35-24(26,27)28/h1-12,20H,13H2,(H,30,33)(H2,29,32,34)/b31-21+ |
| InChIKey | IURQQVRYJJESLV-NJZRLIGZSA-N |
| XLogP | 5.12 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.88 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|