C18H16F4N4O4 — CID 134104383
methyl N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]carbamate (PubChem CID 134104383) has the molecular formula C18H16F4N4O4 and a molecular weight of 428.34 g/mol. Its IUPAC name is methyl N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]carbamate.
| Compound Name | methyl N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]carbamate |
|---|---|
| PubChem CID | 134104383 |
| Molecular Formula | C18H16F4N4O4 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | methyl N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]carbamate |
| SMILES | COC(=O)NC/C(=N/NC(=O)Nc1ccc(OC(F)(F)F)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H16F4N4O4/c1-29-17(28)23-10-15(11-3-2-4-12(19)9-11)25-26-16(27)24-13-5-7-14(8-6-13)30-18(20,21)22/h2-9H,10H2,1H3,(H,23,28)(H2,24,26,27)/b25-15- |
| InChIKey | GVANUMIHWNXVNJ-MYYYXRDXSA-N |
| XLogP | 3.61 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|