C24H16F6N4O2 — CID 59438719
1-[(E)-[2-(4-isocyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 59438719) has the molecular formula C24H16F6N4O2 and a molecular weight of 506.41 g/mol. Its IUPAC name is 1-[(E)-[2-(4-isocyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(E)-[2-(4-isocyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 59438719 |
| Molecular Formula | C24H16F6N4O2 |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 1-[(E)-[2-(4-isocyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | [C-]#[N+]c1ccc(C/C(=N\NC(=O)Nc2ccc(OC(F)(F)F)cc2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H16F6N4O2/c1-31-18-7-5-15(6-8-18)13-21(16-3-2-4-17(14-16)23(25,26)27)33-34-22(35)32-19-9-11-20(12-10-19)36-24(28,29)30/h2-12,14H,13H2,(H2,32,34,35)/b33-21+ |
| InChIKey | RAIRPDABBPBLST-QNKGDIEWSA-N |
| XLogP | 6.92 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|