C23H15F6N3O — CID 141324914
4-[2-[[4-(trifluoromethoxy)phenyl]hydrazinylidene]-2-[3-(trifluoromethyl)phenyl]ethyl]benzonitrile (PubChem CID 141324914) has the molecular formula C23H15F6N3O and a molecular weight of 463.38 g/mol. Its IUPAC name is 4-[2-[[4-(trifluoromethoxy)phenyl]hydrazinylidene]-2-[3-(trifluoromethyl)phenyl]ethyl]benzonitrile.
| Compound Name | 4-[2-[[4-(trifluoromethoxy)phenyl]hydrazinylidene]-2-[3-(trifluoromethyl)phenyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 141324914 |
| Molecular Formula | C23H15F6N3O |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 4-[2-[[4-(trifluoromethoxy)phenyl]hydrazinylidene]-2-[3-(trifluoromethyl)phenyl]ethyl]benzonitrile |
| SMILES | N#Cc1ccc(CC(=NNc2ccc(OC(F)(F)F)cc2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H15F6N3O/c24-22(25,26)18-3-1-2-17(13-18)21(12-15-4-6-16(14-30)7-5-15)32-31-19-8-10-20(11-9-19)33-23(27,28)29/h1-11,13,31H,12H2 |
| InChIKey | IVLMVNXRHFKLNP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|