C23H17F3N4O2 — CID 89211309
1-[[2-(4-cyanophenyl)-1-[4-(trifluoromethyl)phenyl]ethylidene]amino]-3-(4-hydroxyphenyl)urea (PubChem CID 89211309) has the molecular formula C23H17F3N4O2 and a molecular weight of 438.41 g/mol. Its IUPAC name is 1-[[2-(4-cyanophenyl)-1-[4-(trifluoromethyl)phenyl]ethylidene]amino]-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-[[2-(4-cyanophenyl)-1-[4-(trifluoromethyl)phenyl]ethylidene]amino]-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 89211309 |
| Molecular Formula | C23H17F3N4O2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1-[[2-(4-cyanophenyl)-1-[4-(trifluoromethyl)phenyl]ethylidene]amino]-3-(4-hydroxyphenyl)urea |
| SMILES | N#Cc1ccc(CC(=NNC(=O)Nc2ccc(O)cc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H17F3N4O2/c24-23(25,26)18-7-5-17(6-8-18)21(13-15-1-3-16(14-27)4-2-15)29-30-22(32)28-19-9-11-20(31)12-10-19/h1-12,31H,13H2,(H2,28,30,32) |
| InChIKey | CHDCURCXICXLLW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|