C23H18F5N3O3 — CID 134106595
1-[(E)-[1-[4-(difluoromethoxy)phenyl]-2-phenylethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 134106595) has the molecular formula C23H18F5N3O3 and a molecular weight of 479.41 g/mol. Its IUPAC name is 1-[(E)-[1-[4-(difluoromethoxy)phenyl]-2-phenylethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(E)-[1-[4-(difluoromethoxy)phenyl]-2-phenylethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 134106595 |
| Molecular Formula | C23H18F5N3O3 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 1-[(E)-[1-[4-(difluoromethoxy)phenyl]-2-phenylethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(N/N=C(\Cc1ccccc1)c1ccc(OC(F)F)cc1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H18F5N3O3/c24-21(25)33-18-10-6-16(7-11-18)20(14-15-4-2-1-3-5-15)30-31-22(32)29-17-8-12-19(13-9-17)34-23(26,27)28/h1-13,21H,14H2,(H2,29,31,32)/b30-20+ |
| InChIKey | YQNDADXSGVSIDJ-TWKHWXDSSA-N |
| XLogP | 5.96 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|