C18H14F3N3O2 — CID 2383224
2-(4-cyanophenoxy)-N'-[1-[3-(trifluoromethyl)phenyl]ethenyl]acetohydrazide (PubChem CID 2383224) has the molecular formula C18H14F3N3O2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N'-[1-[3-(trifluoromethyl)phenyl]ethenyl]acetohydrazide.
| Compound Name | 2-(4-cyanophenoxy)-N'-[1-[3-(trifluoromethyl)phenyl]ethenyl]acetohydrazide |
|---|---|
| PubChem CID | 2383224 |
| Molecular Formula | C18H14F3N3O2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-(4-cyanophenoxy)-N'-[1-[3-(trifluoromethyl)phenyl]ethenyl]acetohydrazide |
| SMILES | C=C(NNC(=O)COc1ccc(C#N)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F3N3O2/c1-12(14-3-2-4-15(9-14)18(19,20)21)23-24-17(25)11-26-16-7-5-13(10-22)6-8-16/h2-9,23H,1,11H2,(H,24,25) |
| InChIKey | VRRDHWZLUBQCFD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|