About [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate
[4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate (PubChem CID 8802466) has the molecular formula C16H10F3NO2
and a molecular weight of 305.26 g/mol. Its IUPAC name is [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate |
| PubChem CID | 8802466 |
| Molecular Formula | C16H10F3NO2 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate |
| SMILES | N#CCc1ccc(OC(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H10F3NO2/c17-16(18,19)13-3-1-2-12(10-13)15(21)22-14-6-4-11(5-7-14)8-9-20/h1-7,10H,8H2 |
| InChIKey | CMMSVWYTFXBQEX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate?
The IUPAC name of [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate (CID 8802466) is [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate.
What is the SMILES notation for [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate?
The canonical SMILES for [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate is N#CCc1ccc(OC(=O)c2cccc(C(F)(F)F)c2)cc1.
What is the InChIKey of [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate?
The InChIKey is CMMSVWYTFXBQEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F3NO2/c17-16(18,19)13-3-1-2-12(10-13)15(21)22-14-6-4-11(5-7-14)8-9-20/h1-7,10H,8H2.
What are the key properties of [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate?
[4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate has a molecular weight of 305.26 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(cyanomethyl)phenyl] 3-(trifluoromethyl)benzoate is sourced from PubChem (CID 8802466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).