C24H13F6NO2 — CID 39112779
[4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3,5-bis(trifluoromethyl)benzoate (PubChem CID 39112779) has the molecular formula C24H13F6NO2 and a molecular weight of 461.36 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 39112779 |
| Molecular Formula | C24H13F6NO2 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | [4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3,5-bis(trifluoromethyl)benzoate |
| SMILES | N#C/C(=C/c1ccc(OC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H13F6NO2/c25-23(26,27)19-11-17(12-20(13-19)24(28,29)30)22(32)33-21-8-6-15(7-9-21)10-18(14-31)16-4-2-1-3-5-16/h1-13H/b18-10- |
| InChIKey | NFLVSZYFTOCUKY-ZDLGFXPLSA-N |
| XLogP | 7.01 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|