C21H12Cl2N2O2 — CID 2826008
[4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] 3,5-dichlorobenzoate (PubChem CID 2826008) has the molecular formula C21H12Cl2N2O2 and a molecular weight of 395.25 g/mol. Its IUPAC name is [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] 3,5-dichlorobenzoate.
| Compound Name | [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2826008 |
| Molecular Formula | C21H12Cl2N2O2 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] 3,5-dichlorobenzoate |
| SMILES | N#CC(=Cc1ccc(OC(=O)c2cc(Cl)cc(Cl)c2)cc1)c1ccccn1 |
| InChI | InChI=1S/C21H12Cl2N2O2/c22-17-10-15(11-18(23)12-17)21(26)27-19-6-4-14(5-7-19)9-16(13-24)20-3-1-2-8-25-20/h1-12H |
| InChIKey | GQRJNTNFVREIEU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|