C17H9Cl4NO2 — CID 39114006
[4-[(E)-2-(3-chlorophenyl)-2-cyanoethenyl]phenyl] 2,2,2-trichloroacetate (PubChem CID 39114006) has the molecular formula C17H9Cl4NO2 and a molecular weight of 401.08 g/mol. Its IUPAC name is [4-[(E)-2-(3-chlorophenyl)-2-cyanoethenyl]phenyl] 2,2,2-trichloroacetate.
| Compound Name | [4-[(E)-2-(3-chlorophenyl)-2-cyanoethenyl]phenyl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 39114006 |
| Molecular Formula | C17H9Cl4NO2 |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 398.94 |
| IUPAC Name | [4-[(E)-2-(3-chlorophenyl)-2-cyanoethenyl]phenyl] 2,2,2-trichloroacetate |
| SMILES | N#C/C(=C/c1ccc(OC(=O)C(Cl)(Cl)Cl)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H9Cl4NO2/c18-14-3-1-2-12(9-14)13(10-22)8-11-4-6-15(7-5-11)24-16(23)17(19,20)21/h1-9H/b13-8- |
| InChIKey | HHZQAMZRIANSHO-JYRVWZFOSA-N |
| XLogP | 5.68 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|