C18H12Cl3NO3 — CID 39113423
[4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] 2,2,2-trichloroacetate (PubChem CID 39113423) has the molecular formula C18H12Cl3NO3 and a molecular weight of 396.66 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] 2,2,2-trichloroacetate.
| Compound Name | [4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 39113423 |
| Molecular Formula | C18H12Cl3NO3 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | [4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] 2,2,2-trichloroacetate |
| SMILES | COc1ccccc1/C(C#N)=C\c1ccc(OC(=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C18H12Cl3NO3/c1-24-16-5-3-2-4-15(16)13(11-22)10-12-6-8-14(9-7-12)25-17(23)18(19,20)21/h2-10H,1H3/b13-10- |
| InChIKey | SDPYLQZQDNMABH-RAXLEYEMSA-N |
| XLogP | 5.03 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|