C25H27NO3 — CID 39113383
[4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] 3-cyclohexylpropanoate (PubChem CID 39113383) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] 3-cyclohexylpropanoate.
| Compound Name | [4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 39113383 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] 3-cyclohexylpropanoate |
| SMILES | COc1ccccc1/C(C#N)=C\c1ccc(OC(=O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H27NO3/c1-28-24-10-6-5-9-23(24)21(18-26)17-20-11-14-22(15-12-20)29-25(27)16-13-19-7-3-2-4-8-19/h5-6,9-12,14-15,17,19H,2-4,7-8,13,16H2,1H3/b21-17- |
| InChIKey | GKIQVHWGTQTWQP-FXBPSFAMSA-N |
| XLogP | 6.03 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|