C21H19NO4 — CID 39114369
[4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]-2-methoxyphenyl] cyclopropanecarboxylate (PubChem CID 39114369) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]-2-methoxyphenyl] cyclopropanecarboxylate.
| Compound Name | [4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]-2-methoxyphenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 39114369 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [4-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]-2-methoxyphenyl] cyclopropanecarboxylate |
| SMILES | COc1cc(/C=C(/C#N)c2ccccc2OC)ccc1OC(=O)C1CC1 |
| InChI | InChI=1S/C21H19NO4/c1-24-18-6-4-3-5-17(18)16(13-22)11-14-7-10-19(20(12-14)25-2)26-21(23)15-8-9-15/h3-7,10-12,15H,8-9H2,1-2H3/b16-11- |
| InChIKey | UWRCFXAMTAMUBA-WJDWOHSUSA-N |
| XLogP | 4.08 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|