C15H9Cl2N — CID 696997
(E)-2,3-bis(3-chlorophenyl)prop-2-enenitrile (PubChem CID 696997) has the molecular formula C15H9Cl2N and a molecular weight of 274.15 g/mol. Its IUPAC name is (E)-2,3-bis(3-chlorophenyl)prop-2-enenitrile.
| Compound Name | (E)-2,3-bis(3-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 696997 |
| Molecular Formula | C15H9Cl2N |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | (E)-2,3-bis(3-chlorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H9Cl2N/c16-14-5-1-3-11(8-14)7-13(10-18)12-4-2-6-15(17)9-12/h1-9H/b13-7- |
| InChIKey | JTVDFTRRTYDIIZ-QPEQYQDCSA-N |
| XLogP | 5.06 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|