C14H11ClN2S — CID 39373785
(E)-3-(3-chlorophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 39373785) has the molecular formula C14H11ClN2S and a molecular weight of 274.78 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-chlorophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 39373785 |
| Molecular Formula | C14H11ClN2S |
| Molecular Weight | 274.78 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1nc(/C(C#N)=C/c2cccc(Cl)c2)sc1C |
| InChI | InChI=1S/C14H11ClN2S/c1-9-10(2)18-14(17-9)12(8-16)6-11-4-3-5-13(15)7-11/h3-7H,1-2H3/b12-6+ |
| InChIKey | NSQXOTLARWGQFC-WUXMJOGZSA-N |
| XLogP | 4.48 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|