C17H9IN2OS — CID 6194023
(E)-3-(3-iodophenyl)-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile (PubChem CID 6194023) has the molecular formula C17H9IN2OS and a molecular weight of 416.24 g/mol. Its IUPAC name is (E)-3-(3-iodophenyl)-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-iodophenyl)-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6194023 |
| Molecular Formula | C17H9IN2OS |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | (E)-3-(3-iodophenyl)-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cccc(I)c1)c1nc(=O)c2ccccc2s1 |
| InChI | InChI=1S/C17H9IN2OS/c18-13-5-3-4-11(9-13)8-12(10-19)17-20-16(21)14-6-1-2-7-15(14)22-17/h1-9H/b12-8+ |
| InChIKey | ANHQEMWNIDDYDZ-XYOKQWHBSA-N |
| XLogP | 4.33 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|