C12H5BrF2N2O2S — CID 135607817
(Z)-4-bromo-4,4-difluoro-3-hydroxy-2-(4-oxo-1,3-benzothiazin-2-yl)but-2-enenitrile (PubChem CID 135607817) has the molecular formula C12H5BrF2N2O2S and a molecular weight of 359.15 g/mol. Its IUPAC name is (Z)-4-bromo-4,4-difluoro-3-hydroxy-2-(4-oxo-1,3-benzothiazin-2-yl)but-2-enenitrile.
| Compound Name | (Z)-4-bromo-4,4-difluoro-3-hydroxy-2-(4-oxo-1,3-benzothiazin-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 135607817 |
| Molecular Formula | C12H5BrF2N2O2S |
| Molecular Weight | 359.15 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | (Z)-4-bromo-4,4-difluoro-3-hydroxy-2-(4-oxo-1,3-benzothiazin-2-yl)but-2-enenitrile |
| SMILES | N#C/C(=C(/O)C(F)(F)Br)c1nc(=O)c2ccccc2s1 |
| InChI | InChI=1S/C12H5BrF2N2O2S/c13-12(14,15)9(18)7(5-16)11-17-10(19)6-3-1-2-4-8(6)20-11/h1-4,18H/b9-7- |
| InChIKey | KAWDTNUYVUWEAG-CLFYSBASSA-N |
| XLogP | 3.44 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.15 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|