C15H8N2OS — CID 58610096
4-(4-oxo-1,3-benzothiazin-2-yl)benzonitrile (PubChem CID 58610096) has the molecular formula C15H8N2OS and a molecular weight of 264.31 g/mol. Its IUPAC name is 4-(4-oxo-1,3-benzothiazin-2-yl)benzonitrile.
| Compound Name | 4-(4-oxo-1,3-benzothiazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 58610096 |
| Molecular Formula | C15H8N2OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 4-(4-oxo-1,3-benzothiazin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(=O)c3ccccc3s2)cc1 |
| InChI | InChI=1S/C15H8N2OS/c16-9-10-5-7-11(8-6-10)15-17-14(18)12-3-1-2-4-13(12)19-15/h1-8H |
| InChIKey | RXPFLIPPNLWIEX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |