C20H15N3OS — CID 59750226
2-[6-(benzylamino)-3-pyridinyl]-1,3-benzothiazin-4-one (PubChem CID 59750226) has the molecular formula C20H15N3OS and a molecular weight of 345.43 g/mol. Its IUPAC name is 2-[6-(benzylamino)-3-pyridinyl]-1,3-benzothiazin-4-one.
| Compound Name | 2-[6-(benzylamino)-3-pyridinyl]-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 59750226 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[6-(benzylamino)-3-pyridinyl]-1,3-benzothiazin-4-one |
| SMILES | O=c1nc(-c2ccc(NCc3ccccc3)nc2)sc2ccccc12 |
| InChI | InChI=1S/C20H15N3OS/c24-19-16-8-4-5-9-17(16)25-20(23-19)15-10-11-18(22-13-15)21-12-14-6-2-1-3-7-14/h1-11,13H,12H2,(H,21,22) |
| InChIKey | SIBWBDBTHGCRLT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |