C17H10N2OS — CID 59750384
2-quinolin-3-yl-1,3-benzothiazin-4-one (PubChem CID 59750384) has the molecular formula C17H10N2OS and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-quinolin-3-yl-1,3-benzothiazin-4-one.
| Compound Name | 2-quinolin-3-yl-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 59750384 |
| Molecular Formula | C17H10N2OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-quinolin-3-yl-1,3-benzothiazin-4-one |
| SMILES | O=c1nc(-c2cnc3ccccc3c2)sc2ccccc12 |
| InChI | InChI=1S/C17H10N2OS/c20-16-13-6-2-4-8-15(13)21-17(19-16)12-9-11-5-1-3-7-14(11)18-10-12/h1-10H |
| InChIKey | WFVPNDHLXGILOH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |