C14H8Cl2N2 — CID 86078303
3-(2,6-dichloro-4-pyridinyl)quinoline (PubChem CID 86078303) has the molecular formula C14H8Cl2N2 and a molecular weight of 275.14 g/mol. Its IUPAC name is 3-(2,6-dichloro-4-pyridinyl)quinoline.
| Compound Name | 3-(2,6-dichloro-4-pyridinyl)quinoline |
|---|---|
| PubChem CID | 86078303 |
| Molecular Formula | C14H8Cl2N2 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 3-(2,6-dichloro-4-pyridinyl)quinoline |
| SMILES | Clc1cc(-c2cnc3ccccc3c2)cc(Cl)n1 |
| InChI | InChI=1S/C14H8Cl2N2/c15-13-6-10(7-14(16)18-13)11-5-9-3-1-2-4-12(9)17-8-11/h1-8H |
| InChIKey | OSGSVGALUWALKP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|