C29H17F6N — CID 171056228
3-[4-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]phenyl]quinoline (PubChem CID 171056228) has the molecular formula C29H17F6N and a molecular weight of 493.45 g/mol. Its IUPAC name is 3-[4-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]phenyl]quinoline.
| Compound Name | 3-[4-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]phenyl]quinoline |
|---|---|
| PubChem CID | 171056228 |
| Molecular Formula | C29H17F6N |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 3-[4-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]phenyl]quinoline |
| SMILES | FC(F)(F)c1cc(-c2ccc(-c3ccc(-c4cnc5ccccc5c4)cc3)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H17F6N/c30-28(31,32)25-14-23(15-26(16-25)29(33,34)35)20-9-5-18(6-10-20)19-7-11-21(12-8-19)24-13-22-3-1-2-4-27(22)36-17-24/h1-17H |
| InChIKey | ILKGVTXBFXSORU-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |