C34H20F6N2 — CID 169293936
7-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-3-(4-pyridin-2-ylphenyl)quinoline (PubChem CID 169293936) has the molecular formula C34H20F6N2 and a molecular weight of 570.54 g/mol. Its IUPAC name is 7-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-3-(4-pyridin-2-ylphenyl)quinoline.
| Compound Name | 7-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-3-(4-pyridin-2-ylphenyl)quinoline |
|---|---|
| PubChem CID | 169293936 |
| Molecular Formula | C34H20F6N2 |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 7-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-3-(4-pyridin-2-ylphenyl)quinoline |
| SMILES | FC(F)(F)c1cc(-c2ccc(-c3ccc4cc(-c5ccc(-c6ccccn6)cc5)cnc4c3)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H20F6N2/c35-33(36,37)29-16-27(17-30(19-29)34(38,39)40)22-6-4-21(5-7-22)25-12-13-26-15-28(20-42-32(26)18-25)23-8-10-24(11-9-23)31-3-1-2-14-41-31/h1-20H |
| InChIKey | LPSLTLSDSKEVJK-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |