C28H16F6N2 — CID 169293842
7-[3,5-bis(trifluoromethyl)phenyl]-3-(4-pyridin-2-ylphenyl)quinoline (PubChem CID 169293842) has the molecular formula C28H16F6N2 and a molecular weight of 494.44 g/mol. Its IUPAC name is 7-[3,5-bis(trifluoromethyl)phenyl]-3-(4-pyridin-2-ylphenyl)quinoline.
| Compound Name | 7-[3,5-bis(trifluoromethyl)phenyl]-3-(4-pyridin-2-ylphenyl)quinoline |
|---|---|
| PubChem CID | 169293842 |
| Molecular Formula | C28H16F6N2 |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 7-[3,5-bis(trifluoromethyl)phenyl]-3-(4-pyridin-2-ylphenyl)quinoline |
| SMILES | FC(F)(F)c1cc(-c2ccc3cc(-c4ccc(-c5ccccn5)cc4)cnc3c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H16F6N2/c29-27(30,31)23-12-21(13-24(15-23)28(32,33)34)19-8-9-20-11-22(16-36-26(20)14-19)17-4-6-18(7-5-17)25-3-1-2-10-35-25/h1-16H |
| InChIKey | AFTGDCGLWOXBAT-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |