C15H8F3NOS — CID 58610099
2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazin-4-one (PubChem CID 58610099) has the molecular formula C15H8F3NOS and a molecular weight of 307.30 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazin-4-one.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 58610099 |
| Molecular Formula | C15H8F3NOS |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazin-4-one |
| SMILES | O=c1nc(-c2ccc(C(F)(F)F)cc2)sc2ccccc12 |
| InChI | InChI=1S/C15H8F3NOS/c16-15(17,18)10-7-5-9(6-8-10)14-19-13(20)11-3-1-2-4-12(11)21-14/h1-8H |
| InChIKey | LJHYBNRJHGMNQU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |