C9H4F3NOS2 — CID 124928452
5-[4-(trifluoromethyl)phenyl]-1,2,4-dithiazol-3-one (PubChem CID 124928452) has the molecular formula C9H4F3NOS2 and a molecular weight of 263.27 g/mol. Its IUPAC name is 5-[4-(trifluoromethyl)phenyl]-1,2,4-dithiazol-3-one.
| Compound Name | 5-[4-(trifluoromethyl)phenyl]-1,2,4-dithiazol-3-one |
|---|---|
| PubChem CID | 124928452 |
| Molecular Formula | C9H4F3NOS2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | 5-[4-(trifluoromethyl)phenyl]-1,2,4-dithiazol-3-one |
| SMILES | O=c1nc(-c2ccc(C(F)(F)F)cc2)ss1 |
| InChI | InChI=1S/C9H4F3NOS2/c10-9(11,12)6-3-1-5(2-4-6)7-13-8(14)16-15-7/h1-4H |
| InChIKey | YUAMPXUDEJICLN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |