C11H9BF3NO2S — CID 67450720
[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid (PubChem CID 67450720) has the molecular formula C11H9BF3NO2S and a molecular weight of 287.07 g/mol. Its IUPAC name is [4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid.
| Compound Name | [4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid |
|---|---|
| PubChem CID | 67450720 |
| Molecular Formula | C11H9BF3NO2S |
| Molecular Weight | 287.07 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | [4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1B(O)O |
| InChI | InChI=1S/C11H9BF3NO2S/c1-6-9(12(17)18)19-10(16-6)7-2-4-8(5-3-7)11(13,14)15/h2-5,17-18H,1H3 |
| InChIKey | HNMQQYJEBMSHFB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.07 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|