C33H16F6OS2 — CID 102097400
14,21-bis[4-(trifluoromethyl)phenyl]-6,8-dithiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,9,11,13,15,17,19-nonaen-7-one (PubChem CID 102097400) has the molecular formula C33H16F6OS2 and a molecular weight of 606.61 g/mol. Its IUPAC name is 14,21-bis[4-(trifluoromethyl)phenyl]-6,8-dithiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,9,11,13,15,17,19-nonaen-7-one.
| Compound Name | 14,21-bis[4-(trifluoromethyl)phenyl]-6,8-dithiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,9,11,13,15,17,19-nonaen-7-one |
|---|---|
| PubChem CID | 102097400 |
| Molecular Formula | C33H16F6OS2 |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.05 |
| IUPAC Name | 14,21-bis[4-(trifluoromethyl)phenyl]-6,8-dithiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,9,11,13,15,17,19-nonaen-7-one |
| SMILES | O=c1sc2cc3cc4c(-c5ccc(C(F)(F)F)cc5)c5ccccc5c(-c5ccc(C(F)(F)F)cc5)c4cc3cc2s1 |
| InChI | InChI=1S/C33H16F6OS2/c34-32(35,36)21-9-5-17(6-10-21)29-23-3-1-2-4-24(23)30(18-7-11-22(12-8-18)33(37,38)39)26-14-20-16-28-27(41-31(40)42-28)15-19(20)13-25(26)29/h1-16H |
| InChIKey | KVUTUVXZEBSFCL-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|