C68H42F6 — CID 23542883
2,8-diphenyl-5,11-bis(4-phenylphenyl)-6,12-bis[4-(trifluoromethyl)phenyl]tetracene (PubChem CID 23542883) has the molecular formula C68H42F6 and a molecular weight of 973.07 g/mol. Its IUPAC name is 2,8-diphenyl-5,11-bis(4-phenylphenyl)-6,12-bis[4-(trifluoromethyl)phenyl]tetracene.
| Compound Name | 2,8-diphenyl-5,11-bis(4-phenylphenyl)-6,12-bis[4-(trifluoromethyl)phenyl]tetracene |
|---|---|
| PubChem CID | 23542883 |
| Molecular Formula | C68H42F6 |
| Molecular Weight | 973.07 g/mol |
| Exact Mass | 972.32 |
| IUPAC Name | 2,8-diphenyl-5,11-bis(4-phenylphenyl)-6,12-bis[4-(trifluoromethyl)phenyl]tetracene |
| SMILES | FC(F)(F)c1ccc(-c2c3cc(-c4ccccc4)ccc3c(-c3ccc(-c4ccccc4)cc3)c3c(-c4ccc(C(F)(F)F)cc4)c4cc(-c5ccccc5)ccc4c(-c4ccc(-c5ccccc5)cc4)c23)cc1 |
| InChI | InChI=1S/C68H42F6/c69-67(70,71)55-35-29-51(30-36-55)63-60-42-54(46-19-11-4-12-20-46)34-40-58(60)62(50-27-23-48(24-28-50)44-15-7-2-8-16-44)66-64(52-31-37-56(38-32-52)68(72,73)74)59-41-53(45-17-9-3-10-18-45)33-39-57(59)61(65(63)66)49-25-21-47(22-26-49)43-13-5-1-6-14-43/h1-42H |
| InChIKey | BJUBPOTWVFFNBI-UHFFFAOYSA-N |
| XLogP | 20.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.07 |
| LogP ≤ 5 | 20.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|