C70H42F12 — CID 89278204
6-cyclohexa-2,4-dien-1-yl-12-phenyl-2,8-bis[3-(trifluoromethyl)phenyl]-5,11-bis[4-[3-(trifluoromethyl)phenyl]phenyl]tetracene (PubChem CID 89278204) has the molecular formula C70H42F12 and a molecular weight of 1111.08 g/mol. Its IUPAC name is 6-cyclohexa-2,4-dien-1-yl-12-phenyl-2,8-bis[3-(trifluoromethyl)phenyl]-5,11-bis[4-[3-(trifluoromethyl)phenyl]phenyl]tetracene.
| Compound Name | 6-cyclohexa-2,4-dien-1-yl-12-phenyl-2,8-bis[3-(trifluoromethyl)phenyl]-5,11-bis[4-[3-(trifluoromethyl)phenyl]phenyl]tetracene |
|---|---|
| PubChem CID | 89278204 |
| Molecular Formula | C70H42F12 |
| Molecular Weight | 1111.08 g/mol |
| Exact Mass | 1110.31 |
| IUPAC Name | 6-cyclohexa-2,4-dien-1-yl-12-phenyl-2,8-bis[3-(trifluoromethyl)phenyl]-5,11-bis[4-[3-(trifluoromethyl)phenyl]phenyl]tetracene |
| SMILES | FC(F)(F)c1cccc(-c2ccc(-c3c4ccc(-c5cccc(C(F)(F)F)c5)cc4c(C4C=CC=CC4)c4c(-c5ccc(-c6cccc(C(F)(F)F)c6)cc5)c5ccc(-c6cccc(C(F)(F)F)c6)cc5c(-c5ccccc5)c34)cc2)c1 |
| InChI | InChI=1S/C70H42F12/c71-67(72,73)53-19-7-15-47(35-53)41-23-27-45(28-24-41)61-58-34-32-52(50-18-10-22-56(38-50)70(80,81)82)40-60(58)64(44-13-5-2-6-14-44)66-62(46-29-25-42(26-30-46)48-16-8-20-54(36-48)68(74,75)76)57-33-31-51(49-17-9-21-55(37-49)69(77,78)79)39-59(57)63(65(61)66)43-11-3-1-4-12-43/h1-13,15-40,44H,14H2 |
| InChIKey | IIKLSSNAYGCRLL-UHFFFAOYSA-N |
| XLogP | 22.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1111.08 |
| LogP ≤ 5 | 22.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|