C23H14N2O2S — CID 4702359
2-(4-oxo-1,3-benzothiazin-2-yl)-3-(3-phenoxyphenyl)prop-2-enenitrile (PubChem CID 4702359) has the molecular formula C23H14N2O2S and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-(4-oxo-1,3-benzothiazin-2-yl)-3-(3-phenoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(4-oxo-1,3-benzothiazin-2-yl)-3-(3-phenoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4702359 |
| Molecular Formula | C23H14N2O2S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-(4-oxo-1,3-benzothiazin-2-yl)-3-(3-phenoxyphenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cccc(Oc2ccccc2)c1)c1nc(=O)c2ccccc2s1 |
| InChI | InChI=1S/C23H14N2O2S/c24-15-17(23-25-22(26)20-11-4-5-12-21(20)28-23)13-16-7-6-10-19(14-16)27-18-8-2-1-3-9-18/h1-14H |
| InChIKey | APFUTOMAWOPZHJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|