C17H9N3O3S — CID 6194010
(E)-3-(4-nitrophenyl)-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile (PubChem CID 6194010) has the molecular formula C17H9N3O3S and a molecular weight of 335.34 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-nitrophenyl)-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6194010 |
| Molecular Formula | C17H9N3O3S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc([N+](=O)[O-])cc1)c1nc(=O)c2ccccc2s1 |
| InChI | InChI=1S/C17H9N3O3S/c18-10-12(9-11-5-7-13(8-6-11)20(22)23)17-19-16(21)14-3-1-2-4-15(14)24-17/h1-9H/b12-9+ |
| InChIKey | BJPJOLUARBEAHQ-FMIVXFBMSA-N |
| XLogP | 3.63 |
| TPSA | 96.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|