C14H7N3O2S2 — CID 100907213
(Z)-2-(1,3-benzothiazol-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile (PubChem CID 100907213) has the molecular formula C14H7N3O2S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 100907213 |
| Molecular Formula | C14H7N3O2S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc([N+](=O)[O-])s1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H7N3O2S2/c15-8-9(7-10-5-6-13(20-10)17(18)19)14-16-11-3-1-2-4-12(11)21-14/h1-7H/b9-7- |
| InChIKey | CNCAYVJOGWWUPY-CLFYSBASSA-N |
| XLogP | 4.33 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|