C13H7N5O2S — CID 25110830
(E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile (PubChem CID 25110830) has the molecular formula C13H7N5O2S and a molecular weight of 297.30 g/mol. Its IUPAC name is (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 25110830 |
| Molecular Formula | C13H7N5O2S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc([N+](=O)[O-])s1)c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C13H7N5O2S/c14-7-8(6-9-3-4-11(21-9)18(19)20)12-16-10-2-1-5-15-13(10)17-12/h1-6H,(H,15,16,17)/b8-6+ |
| InChIKey | JRKPUDUDUSYUTF-SOFGYWHQSA-N |
| XLogP | 2.99 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|