C15H9N5O2 — CID 3781883
2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 3781883) has the molecular formula C15H9N5O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | 2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3781883 |
| Molecular Formula | C15H9N5O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc([N+](=O)[O-])cc1)c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C15H9N5O2/c16-9-11(8-10-3-5-12(6-4-10)20(21)22)14-18-13-2-1-7-17-15(13)19-14/h1-8H,(H,17,18,19) |
| InChIKey | CZICAQDPOMYFBI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|