C22H14N6O4 — CID 39386045
(Z)-2-(1H-benzimidazol-2-yl)-3-[4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl]prop-2-enenitrile (PubChem CID 39386045) has the molecular formula C22H14N6O4 and a molecular weight of 426.39 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-[4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-[4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 39386045 |
| Molecular Formula | C22H14N6O4 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-[4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(/C=C/c2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H14N6O4/c23-12-15(20-24-16-3-1-2-4-17(16)25-20)11-14-7-5-13(6-8-14)9-10-18-19(28(31)32)21(29)27-22(30)26-18/h1-11H,(H,24,25)(H2,26,27,29,30)/b10-9+,15-11- |
| InChIKey | RDTDTUGBKGXHEN-RKVFCIRRSA-N |
| XLogP | 3.08 |
| TPSA | 161.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|