C23H13F3N4O3 — CID 5083643
2-(1H-benzimidazol-2-yl)-3-[4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]prop-2-enenitrile (PubChem CID 5083643) has the molecular formula C23H13F3N4O3 and a molecular weight of 450.38 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-[4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-[4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5083643 |
| Molecular Formula | C23H13F3N4O3 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-[4-[4-nitro-2-(trifluoromethyl)phenoxy]phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(Oc2ccc([N+](=O)[O-])cc2C(F)(F)F)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H13F3N4O3/c24-23(25,26)18-12-16(30(31)32)7-10-21(18)33-17-8-5-14(6-9-17)11-15(13-27)22-28-19-3-1-2-4-20(19)29-22/h1-12H,(H,28,29) |
| InChIKey | ZXNMHWDUYXBDLT-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 104.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|