C23H12ClF3N4O3 — CID 126093088
(E)-2-(1H-benzimidazol-2-yl)-3-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enenitrile (PubChem CID 126093088) has the molecular formula C23H12ClF3N4O3 and a molecular weight of 484.82 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126093088 |
| Molecular Formula | C23H12ClF3N4O3 |
| Molecular Weight | 484.82 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Cl)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H12ClF3N4O3/c24-16-6-8-20(34-21-7-5-15(23(25,26)27)11-19(21)31(32)33)13(10-16)9-14(12-28)22-29-17-3-1-2-4-18(17)30-22/h1-11H,(H,29,30)/b14-9+ |
| InChIKey | WOONTHZPSRNAGN-NTEUORMPSA-N |
| XLogP | 7.00 |
| TPSA | 104.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.82 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|