C16H8Cl2N4O2 — CID 5336090
(E)-2-(1H-benzimidazol-2-yl)-3-(2,3-dichloro-4-nitrophenyl)prop-2-enenitrile (PubChem CID 5336090) has the molecular formula C16H8Cl2N4O2 and a molecular weight of 359.17 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-(2,3-dichloro-4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-(2,3-dichloro-4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5336090 |
| Molecular Formula | C16H8Cl2N4O2 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-(2,3-dichloro-4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc([N+](=O)[O-])c(Cl)c1Cl)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H8Cl2N4O2/c17-14-9(5-6-13(15(14)18)22(23)24)7-10(8-19)16-20-11-3-1-2-4-12(11)21-16/h1-7H,(H,20,21)/b10-7+ |
| InChIKey | ITSPEGJGOOVWEA-JXMROGBWSA-N |
| XLogP | 4.84 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|