C28H21F3N4O4 — CID 126092341
(E)-2-(1H-benzimidazol-2-yl)-3-[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]prop-2-enenitrile (PubChem CID 126092341) has the molecular formula C28H21F3N4O4 and a molecular weight of 534.49 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126092341 |
| Molecular Formula | C28H21F3N4O4 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]prop-2-enenitrile |
| SMILES | C=CCc1cc(/C=C(\C#N)c2nc3ccccc3[nH]2)cc(OCC)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H21F3N4O4/c1-3-7-18-12-17(13-19(16-32)27-33-21-8-5-6-9-22(21)34-27)14-25(38-4-2)26(18)39-24-11-10-20(28(29,30)31)15-23(24)35(36)37/h3,5-6,8-15H,1,4,7H2,2H3,(H,33,34)/b19-13+ |
| InChIKey | UFMGGRGVOFPSDI-CPNJWEJPSA-N |
| XLogP | 7.47 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|