C23H18F3N3O6S — CID 126083575
5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126083575) has the molecular formula C23H18F3N3O6S and a molecular weight of 521.47 g/mol. Its IUPAC name is 5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126083575 |
| Molecular Formula | C23H18F3N3O6S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCc1cc(C=C2C(=O)NC(=S)NC2=O)cc(OCC)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H18F3N3O6S/c1-3-5-13-8-12(9-15-20(30)27-22(36)28-21(15)31)10-18(34-4-2)19(13)35-17-7-6-14(23(24,25)26)11-16(17)29(32)33/h3,6-11H,1,4-5H2,2H3,(H2,27,28,30,31,36) |
| InChIKey | CVUOXRLLSSGXIW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|