C29H21ClF3N3O7 — CID 126093800
(5E)-1-(3-chloro-2-methylphenyl)-5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126093800) has the molecular formula C29H21ClF3N3O7 and a molecular weight of 615.95 g/mol. Its IUPAC name is (5E)-1-(3-chloro-2-methylphenyl)-5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(3-chloro-2-methylphenyl)-5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126093800 |
| Molecular Formula | C29H21ClF3N3O7 |
| Molecular Weight | 615.95 g/mol |
| Exact Mass | 615.10 |
| IUPAC Name | (5E)-1-(3-chloro-2-methylphenyl)-5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3cccc(Cl)c3C)C2=O)cc(OC)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H21ClF3N3O7/c1-4-6-17-11-16(12-19-26(37)34-28(39)35(27(19)38)21-8-5-7-20(30)15(21)2)13-24(42-3)25(17)43-23-10-9-18(29(31,32)33)14-22(23)36(40)41/h4-5,7-14H,1,6H2,2-3H3,(H,34,37,39)/b19-12+ |
| InChIKey | UDHTUYUMRQBBTA-XDHOZWIPSA-N |
| XLogP | 6.77 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.95 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|