C26H18ClIN4O9 — CID 126089429
(5E)-1-(3-chloro-2-methylphenyl)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxy-5-iodophenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126089429) has the molecular formula C26H18ClIN4O9 and a molecular weight of 692.81 g/mol. Its IUPAC name is (5E)-1-(3-chloro-2-methylphenyl)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxy-5-iodophenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(3-chloro-2-methylphenyl)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxy-5-iodophenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126089429 |
| Molecular Formula | C26H18ClIN4O9 |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 691.98 |
| IUPAC Name | (5E)-1-(3-chloro-2-methylphenyl)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxy-5-iodophenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3cccc(Cl)c3C)C2=O)cc(I)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H18ClIN4O9/c1-3-40-22-11-14(10-18(28)23(22)41-21-8-7-15(31(36)37)12-20(21)32(38)39)9-16-24(33)29-26(35)30(25(16)34)19-6-4-5-17(27)13(19)2/h4-12H,3H2,1-2H3,(H,29,33,35)/b16-9+ |
| InChIKey | UTKXEIVRZPFOTJ-CXUHLZMHSA-N |
| XLogP | 5.93 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|