C25H16Cl2N4O9 — CID 126094808
(5E)-5-[[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]methylidene]-1-(2-chlorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126094808) has the molecular formula C25H16Cl2N4O9 and a molecular weight of 587.33 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]methylidene]-1-(2-chlorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]methylidene]-1-(2-chlorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126094808 |
| Molecular Formula | C25H16Cl2N4O9 |
| Molecular Weight | 587.33 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | (5E)-5-[[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]methylidene]-1-(2-chlorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccccc3Cl)C2=O)cc(Cl)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H16Cl2N4O9/c1-2-39-21-11-13(9-15-23(32)28-25(34)29(24(15)33)18-6-4-3-5-16(18)26)10-17(27)22(21)40-20-8-7-14(30(35)36)12-19(20)31(37)38/h3-12H,2H2,1H3,(H,28,32,34)/b15-9+ |
| InChIKey | JPGVALQGYPJERU-OQLLNIDSSA-N |
| XLogP | 5.67 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.33 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|