C24H13Cl3N4O8 — CID 126084484
(5E)-1-(5-chloro-2-methylphenyl)-5-[[3,5-dichloro-4-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126084484) has the molecular formula C24H13Cl3N4O8 and a molecular weight of 591.75 g/mol. Its IUPAC name is (5E)-1-(5-chloro-2-methylphenyl)-5-[[3,5-dichloro-4-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(5-chloro-2-methylphenyl)-5-[[3,5-dichloro-4-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126084484 |
| Molecular Formula | C24H13Cl3N4O8 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 589.98 |
| IUPAC Name | (5E)-1-(5-chloro-2-methylphenyl)-5-[[3,5-dichloro-4-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(Cl)cc1N1C(=O)NC(=O)/C(=C\c2cc(Cl)c(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Cl)c2)C1=O |
| InChI | InChI=1S/C24H13Cl3N4O8/c1-11-2-3-13(25)9-18(11)29-23(33)15(22(32)28-24(29)34)6-12-7-16(26)21(17(27)8-12)39-20-5-4-14(30(35)36)10-19(20)31(37)38/h2-10H,1H3,(H,28,32,34)/b15-6+ |
| InChIKey | GZDOWLILEXYFOZ-GIDUJCDVSA-N |
| XLogP | 6.23 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|