C28H21ClN4O9 — CID 126086116
(5E)-1-(3-chlorophenyl)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126086116) has the molecular formula C28H21ClN4O9 and a molecular weight of 592.95 g/mol. Its IUPAC name is (5E)-1-(3-chlorophenyl)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(3-chlorophenyl)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126086116 |
| Molecular Formula | C28H21ClN4O9 |
| Molecular Weight | 592.95 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | (5E)-1-(3-chlorophenyl)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3cccc(Cl)c3)C2=O)cc(OCC)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H21ClN4O9/c1-3-6-17-11-16(12-21-26(34)30-28(36)31(27(21)35)19-8-5-7-18(29)14-19)13-24(41-4-2)25(17)42-23-10-9-20(32(37)38)15-22(23)33(39)40/h3,5,7-15H,1,4,6H2,2H3,(H,30,34,36)/b21-12+ |
| InChIKey | MEGCLXUNSQFORW-CIAFOILYSA-N |
| XLogP | 5.74 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.95 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|