C23H23ClN2O4 — CID 5253922
3-(3-chlorophenyl)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 5253922) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | 3-(3-chlorophenyl)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5253922 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-(3-chlorophenyl)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | C=CCc1cc(C=C2NC(=O)N(c3cccc(Cl)c3)C2=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H23ClN2O4/c1-4-8-16-11-15(13-20(29-5-2)21(16)30-6-3)12-19-22(27)26(23(28)25-19)18-10-7-9-17(24)14-18/h4,7,9-14H,1,5-6,8H2,2-3H3,(H,25,28) |
| InChIKey | STXBVAHRNSUILU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|